{ { Drugbox
| IUPAC_name = N,N-Dibutyl-''N-(3-phenyl-1,2,4-oxadiazol-5-yl)ethane-1,2-diamine
| image = butalamine.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 22131-35-7
| ATC_prefix = C04
| ATC_suffix = AX23
| PubChem = 30949
| DrugBank =
| ChEMBL = 1697825
| ChemSpiderID = 28712
| UNII_Ref =
| UNII = 140T9JTG43
| C=18 | H=28 | N=4 | O=1
| smiles = n1c(onc1c2ccccc2)NCCN(CCCC)CCCC
}}Butalamine is a vasodilator.
Synthesis
Check with imolamine (alternate nitrogen reacts)
The halogenation of benzamidoxime [932-90-1] [622-31-1] (1) with chlorine and subsequent reaction with cyanamide (3) gives 5-amino-3-phenyl-1,2,4-oxadiazole [3663-37-4] (4). Base catalyzed alkylation with dibutylaminoethyl chloride [13422-90-7] (5) completes the synthesis of butalamine (6''').